BÀi kiểm tra 1 tiết số 1 Môn: Hóa học



tải về 57.82 Kb.
Chuyển đổi dữ liệu28.05.2018
Kích57.82 Kb.
BÀI KIỂM TRA 1 TIẾT SỐ 1

Môn: Hóa học

Họ tên học sinh:.....................................................Lớp:....

Đối với mỗi câu trắc nghiệm, học sinh chọn và tô kín một ô tròn tương ứng với phương án trả lời đúng.

01. { | } ~ 04. { | } ~ 07. { | } ~ 10. { | } ~

02. { | } ~ 05. { | } ~ 08. { | } ~

03. { | } ~ 06. { | } ~ 09. { | } ~

I. Trắc nghiệm

Câu 1. Cho các chất: metyl clorua, vinyl clorua, anlyl clorua, etyl clorua, điclometan, 1,2-đicloetan, 1,1-đicloetan, 1,2,3-triclopropan, 2-clopropen, triclometan, phenyl clorua, benzyl clorua. Số chất khi thủy phân trong môi trường kiềm ở điều kiện thích hợp thu được ancol là

A. 6. B. 8. C. 7. D. 5.



Câu 2: Geraniol (C10H17OH - có trong tinh dầu hoa hồng) là một trong các dẫn xuất (mạch hở) chứa oxi của tecpen. Số liên kết  trong phân tử geraniol là

A. 4. B. 2. C. 1. D. 3.



Câu 3. Khi đun một ancol X với H2SO4 đặc ở 170oC, thu được 3 anken đồng phân có công thức C7H14. Khi hiđro hoá các anken đó thì đều thu được 2,2-đimetylpentan. Tên gọi của X là

A. 2,2-đimetyl pentan-4-ol. B. 2,2-đimetyl pentan-3-ol.

C. 4,4-đimetyl pentan-2-ol. D. 3,3-đimetyl pentan-2-ol.

Câu 4. Cho 25 ml dung dịch ancol etylic 46o phản ứng hết với kim loại Na (dư), thu được V lít khí H2 (đktc). Biết khối lượng riêng của ancol etylic nguyên chất bằng 0,8 g/ml. Giá trị của V là

A. 4,48. B. 2,24. C. 10,64. D. 11,2.



Câu 5: Chất không thuộc loại hợp chất phenol là

A. CH3-C6H4-OH B. C6H5-CH2-OH C. C2H5-C6H4-OH D. OH-C6H4-OH

Câu 6: Phản ứng chứng minh phenol có tính axit yếu hơn axit cacbonic là

A. phenol tác dụng với kim loại natri.

B. dung dịch natri phenolat tác dụng với khí cacbonic.

C. phenol tác dụng với nước brom.

D. phenol tác dụng với dung dịch kiềm.

Câu 7: Số chất chứa vòng benzen có cùng công thức phân tử C7H8O là

A. 3. B. 4. C. 6. D. 5.



Câu 8: Hợp chất X là dẫn xuất của benzen có công thức phân tử C8H10O2. X tác dụng với NaOH theo tỉ lệ mol 1:1. Mặt khác cho X tác dụng với Na thì số mol H2 thu được đúng bằng số mol của X đã phản ứng. Nếu tách một phân tử H2O từ X thì tạo ra sản phẩm có khả năng trùng hợp tạo polime. Số công thức cấu tạo phù hợp của X là

A. 6. B. 2 . C. 9 . D. 7.

Câu 9. Tên thay thế của geraniol là:

A. cis-3,7-đimetylocta-2,6-đien-1-ol. B. cis-2,6-đimetylocta-3,7-đien-1-ol.

C. trans-3,7-đimetylocta-2,6-đien-1-ol. D. trans-2,6-đimetylocta-3,7-đien-1-ol.

Câu 10. Hợp chất hữu cơ X có công thức phân tử C5H12O, khi tác dụng với CH3MgI giải phóng CH4, khi oxi hóa X tạo được hỗn hợp 2 anđehit (tỉ lệ mol 1:1). Biết rằng X có khả năng làm quay mặt phẳng ánh sáng phân cực. Công thức cấu tạo của X là

A. CH3-CH(CH3)CH2-CH2OH. B. CH3-CH2-C(OH)(CH3)2.

C. CH3-CH(OH)-CH(CH3)CH3. D CH3-CH2-CH(CH3)CH2OH.

II. Tự luận

Câu 1. a. Trong dãy: HF; CH3F; CH3CH2F; CH3CH2CH2F. Chất nào có nhiệt sôi thấp nhất, cao nhất? Giải thích.

b. Viết công thức cấu trúc các ancol sau:

1. hexa-2,3,4-trien-1,6-điol. 2. hepta-2,3,4,5-tetraen-1,7-điol.

3. hepta-2,4-đien-1-ol. 4. xiclopentanđiol.



Câu 2. Đốt cháy hoàn toàn m gam hợp chất hữu cơ A (chỉ chứa 1 loại nhóm chức) thu được tỉ lệ thể tích CO2 và H2O là 6:7. Biết rằng khi cho 1 gam A tác dụng với Na thu được số mol H2 bằng đúng số mol A. Khi chế hóa A với HIO4, THF trong H2O thu được 2 hợp chất chứa nhóm cacbonyl với số nguyên tử C bằng nhau. Xác định công thức cấu tạo và gọi tên A.

Câu 3. Hoàn thành sơ đồ phản ứng:




Y


Z

X

Phenol A B



Đáp án

I. Trắc nghiệm

Câu

1

2

3

4

5

6

7

8

9

10




A

B

C

C

B

B

D

A

C

D

II. Tự luận

Câu 1. Giải:

a. Nhiệt độ sôi HF cao nhất do tạo được liên kết hiđro liên phân tử. Các chất còn lại không có liên kết hiđro nên phụ thuộc vào KLPT, vì thế CH3F có nhiệt độ sôi thấp nhất.

b.

1. Hexa-2,3,4-trien-1,6-điol: CH2OH-CH=C=C=CH-CH2OH có hai đồng phân hình học (cis-trans).



2. Hepta-2,3,4,5-tetraen-1,7-điol: CH2OH-CH=C=C=C=CH-CH2OH có hai đồng phân quang học.

3. Hepta-2,4-đien-1-ol: CH2OH-CH=CH-CH=CH-CH3 có 4 đồng phân hình học: (cis-cis; cis-trans; trans-cis; trans-trans).

4. Xiclopentanđiol có 6 đồng phân cấu trúc:

cis-xiclopentan-1,2-điol

trans-xiclopentan-1,2-điol (1 cặp đối quang)

cis- xiclopentan-1,3-điol

trans-xiclopentan-1,3-điol (1 cặp đối quang)

Câu 2. Giải: C6H14O2; có 3 công thức cấu tạo của A là:

CH3CH2CH(OH)-CH(OH)-CH2-CH3;





Câu 3.

Giải: X: HNO3/ H2SO4 Y: ClCH2COOH

Z: Fe, HCl A: p-NO2-C6H4-OH B: p-NH2-C6H4-OCH2COOH


Cơ sở dữ liệu được bảo vệ bởi bản quyền ©hocday.com 2016
được sử dụng cho việc quản lý

    Quê hương