Nguyễn minh tuấn giáo viên trường thpt chuyên Hùng Vương



trang5/15
Chuyển đổi dữ liệu25.07.2016
Kích1 Mb.
1   2   3   4   5   6   7   8   9   ...   15

Câu 66: Một hỗn hợp A gồm 2 hiđrocacbon X, Y liên tiếp nhau trong cùng dãy đồng đẳng. Đốt cháy 11,2 lít hỗn hợp X thu được 57,2 gam CO2 và 23,4 gam CO2. CTPT X, Y và khối lượng của X, Y là:

A. 12,6 gam C3H6 và 11,2 gam C4H8. B. 8,6 gam C3H6và 11,2 gam C4H8.

C. 5,6 gam C2H4 và 12,6 gam C3H6. D. 2,8 gam C2H4 và 16,8 gam C3H6.

Câu 67: Đốt cháy hoàn toàn 0,05 mol một anken A thu được 4,48 lít CO2 (đktc). Cho A tác dụng với dung dịch HBr chỉ cho một sản phẩm duy nhất. CTCT của A là:

A. CH2=CH2. B. (CH3)2C=C(CH3)2. C. CH2=C(CH3)2. D. CH3CH=CHCH3.

Câu 68: Hỗn hợp X gồm propen là đồng đẳng theo tỉ lệ thể tích 1:1. Đốt 1 thể tích hỗn hợp X cần 3,75 thể tích oxi (cùng đk). Vậy B là:

A. eten. B. propan. C. buten. D. penten.

Câu 69: Đem đốt cháy hoàn toàn 0,1 mol hỗn hợp X gồm 2 anken là đồng đẳng kế tiếp nhau thu được CO2 và nước có khối lượng hơn kém nhau 6,76 gam. CTPT của 2 anken đó là:

A. C2H4 và C3H6. B. C3H6 và C4H8. C. C4H8 và C5H10. D. C5H10 và C6H12.

Câu 70: X, Y, Z là 3 hiđrocacbon kế tiếp trong dãy đồng đẳng, trong đó MZ = 2MX. Đốt cháy hoàn toàn 0,1 mol Y rồi hấp thụ toàn bộ sản phẩm cháy vào 2 lít dung dịch Ba(OH)2 0,1M được một lượng kết tủa là:

A. 19,7 gam. B. 39,4 gam. C. 59,1 gam. D. 9,85 gam.

Câu 71: Chia hỗn hợp gồm C3H6, C2H4, C2H2 thành hai phần đều nhau.

Phần 1: đốt cháy hoàn toàn thu được 2,24 lít CO2 (đktc).

Phần 2: Hiđro hoá rồi đốt cháy hết thì thể tích CO2 thu được (đktc) là bao nhiêu ?

A. 1,12 lít. B. 2,24 lít. C. 4,48 lít. D. 3,36 lít.

Câu 72: Đốt cháy hoàn toàn 20,0 ml hỗn hợp X gồm C3H6, CH4, CO (thể tích CO gấp hai lần thể tích CH4), thu được 24,0 ml CO2 (các thể tích khí đo ở cùng điều kiện nhiệt độ và áp suất). Tỉ khối của X so với khí H2 là:

A. 12,9. B. 25,8. C. 22,2. D. 11,1

Câu 73: Đốt cháy hoàn toàn 0,1 mol anken X thu được CO2 và hơi nước. Hấp thụ hoàn toàn sản phẩm bằng 100 gam dung dịch NaOH 21,62% thu được dung dịch mới trong đó nồng độ của NaOH chỉ còn 5%. Công thức phân tử đúng của X là:

A. C2H4. B. C3H6. C. C4H8. D. C5H10.

Câu 74: X là hỗn hợp gồm hiđrocacbon A và O2 (tỉ lệ mol tương ứng 1:10). Đốt cháy hoàn toàn X được hỗn hợp Y. Dẫn Y qua bình H2SO4 đặc dư được hỗn Z có tỉ khối so với hiđro là 19. A có công thức phân tử là:

A. C2H6. B. C4H8. C C4H6. D. C3H6.

Câu 75: m gam hỗn hợp gồm C3H6, C2H4 và C2H2 cháy hoàn toàn thu được 4,48 lít khí CO2 (đktc). Nếu hiđro hoá hoàn toàn m gam hỗn hợp trên rồi đốt cháy hết hỗn hợp thu được V lít CO2 (đktc). Giá trị của V là:

A. 3,36. B. 2,24. C. 4,48. D. 1,12.

Câu 76: Dẫn 1,68 lít hỗn hợp khí X gồm hai hiđrocacbon vào bình đựng dung dịch brom (dư). Sau khi phản ứng xảy ra hoàn toàn, có 4 gam brom đã phản ứng và còn lại 1,12 lít khí. Nếu đốt cháy hoàn toàn 1,68 lít X thì sinh ra 2,8 lít khí CO2. Công thức phân tử của hai hiđrocacbon là (biết các thể tích khí đều đo ở đktc)

A. CH4 và C2H4. B. CH4 và C3H4. C. CH4 và C3H6. D. C2H6 và C3H6.

Câu 77: Hỗn hợp X gồm C3H8 và C3H6 có tỉ khối so với hiđro là 21,8. Đốt cháy hết 5,6 lít X (đktc) thì thu được bao nhiêu gam CO2 và bao nhiêu gam H2O ?

A. 33 gam và 17,1 gam. B. 22 gam và 9,9 gam.

C. 13,2 gam và 7,2 gam. D. 33 gam và 21,6 gam.

Câu 78: Hiện nay PVC được điều chế theo sơ đồ sau:

C2H4 CH2Cl–CH2Cl C2H3Cl PVC.



Nếu hiệu suất toàn bộ quá trình đạt 80% thì lượng C2H4 cần dùng để sản xuất 5000 kg PVC là:

A. 280 kg. B. 1792 kg. C. 2800 kg. D. 179,2 kg.

Câu 79: Thổi 0,25 mol khí etilen qua 125 ml dung dịch KMnO4 1M trong môi trường trung tính (hiệu suất 100%) khối lượng etylen glicol thu được bằng

A. 11,625 gam. B. 23,25 gam. C. 15,5 gam. D. 31 gam.

Câu 80: Để khử hoàn toàn 200 ml dung dịch KMnO4 0,2M tạo thành chất rắn màu nâu đen cần V lít khí C2H4 (ở đktc). Giá trị tối thiểu của V là:

A. 2,240. B. 2,688. C. 4,480. D. 1,344.

Câu 81: Ba hiđrocacbon X, Y, Z kế tiếp nhau trong dãy đồng đẳng, trong đó khối lượng phân tử Z gấp đôi khối lượng phân tử X. Đốt cháy 0,1 mol chất Z, sản phẩm khí hấp thụ hoàn toàn vào dung dịch Ca(OH)2 (dư), thu được số gam kết tủa là:

A. 20. B. 40. C. 30. D. 10.

Câu 82: Hỗn hợp X có tỉ khối so với H2 là 21,2 gồm propan, propen và propin. Khi đốt cháy hoàn toàn 0,1 mol X, tổng khối lượng của CO2 và H2O thu được là:

A. 18,60 gam. B. 18,96 gam. C. 20,40 gam. D. 16,80 gam.

Câu 83: X là hỗn hợp C4H8 và O2 (tỉ lệ mol tương ứng 1:10). Đốt cháy hoàn toàn X được hỗn hợp Y. Dẫn Y qua bình H2SO4 đặc dư được hỗn Z. Tỉ khối của Z so với hiđro là

A.18. B. 19. C. 20. D. 21.

Câu 84: Hỗn hợp X gồm 2 anken khí phản ứng vừa đủ với dung dịch chứa 48 gam brom. Mặt khác đốt cháy hoàn toàn hỗn hợp X dùng hết 24,64 lít O2 (đktc). Công thức phân tử của 2 anken là:

A. C2H4 và C3H6. B. C2H4 và C4H8. C. C3H6 và C4H8. D. A và B đều đúng.

Câu 85: Đốt cháy một số mol như nhau của 3 hiđrocacbon K, L, M ta thu được lượng CO2 như nhau và tỉ lệ số mol nước và CO2 đối với số mol của K, L, M tương ứng là 0,5 ; 1 ; 1,5. CTPT của K, L, M (viết theo thứ tự tương ứng) là:

A. C2H4, C2H6, C3H4. B. C3H8, C3H4, C2H4. C. C3H4, C3H6, C3H8. D. C2H2, C2H4, C2H6.

BÀI TẬP VỀ ANKAĐIEN -TECPEN - ANKIN
Câu 1: Số đồng phân thuộc loại ankađien ứng với công thức phân tử C5H8

A. 4. B. 5. C. 6. D. 7.

Câu 2: C5H8 có bao nhiêu đồng phân ankađien liên hợp ?

A. 2. B. 3. C. 4. D. 5.

Câu 3: Trong các hiđrocacbon sau: propen, but-1-en, but-2-en, penta-1,4- đien, penta-1,3- đien hiđrocacbon cho được hiện tượng đồng phân cis - trans ?

A. propen, but-1-en. B. penta-1,4-dien, but-1-en.

C. propen, but-2-en. D. but-2-en, penta-1,3- đien.

Câu 4: Công thức phân tử của buta-1,3-đien (đivinyl) và isopren (2-metylbuta-1,3-đien) lần lượt là

A. C4H6 và C5H10. B. C4H4 và C5H8. C. C4H6 và C5H8. D. C4H8 và C5H10.

Câu 5: Hợp chất nào trong số các chất sau có 9 liên kết xích ma và 2 liên kết π ?

A. Buta-1,3-đien. B. Penta-1,3- đien. C. Stiren. D. Vinyl axetilen.

Câu 6: Hợp chất nào trong số các chất sau có 7 liên kết xích ma và 3 liên kết π ?

A. Buta-1,3-đien. B. Tuloen. C. Stiren. D. Vinyl axetilen.

Câu 7: Cho phản ứng giữa buta-1,3-đien và HBr ở -80oC (tỉ lệ mol 1:1), sản phẩm chính của phản ứng là

A. CH3CHBrCH=CH2. B. CH3CH=CHCH2Br.

C. CH2BrCH2CH=CH2. D. CH3CH=CBrCH3.

Câu 8: Cho phản ứng giữa buta-1,3-đien và HBr ở 40oC (tỉ lệ mol 1:1), sản phẩm chính của phản ứng là

A. CH3CHBrCH=CH2. B. CH3CH=CHCH2Br.

C. CH2BrCH2CH=CH2. D. CH3CH=CBrCH3.

Câu 9: 1 mol buta-1,3-đien có thể phản ứng tối đa với bao nhiêu mol brom ?

A. 1 mol. B. 1,5 mol. C. 2 mol. D. 0,5 mol.

Câu 10: Isopren tham gia phản ứng với dung dịch Br2 theo tỉ lệ mol 1:1 tạo ra tối đa bao nhiêu sản phẩm ?

A. 4. B. 1. C. 3. D. 2.

Câu 11: Isopren tham gia phản ứng với dung dịch HBr theo tỉ lệ mol 1:1 tạo ra tối đa bao nhiêu sản phẩm cộng ?

A. 8. B. 5. C. 7. D. 6.

Câu 12: Chất nào sau đây không phải là sản phẩm cộng giữa dung dịch brom và isopren (theo tỉ lệ mol 1:1) ?

A. CH2BrC(CH3)BrCH=CH2. B. CH2BrC(CH3)=CHCH2Br.

C. CH2BrCH=CHCH2CH2Br. D. CH2=C(CH3)CHBrCH2Br.

Câu 13: Ankađien A + brom (dd) CH3C(CH3)BrCH=CHCH2Br. Vậy A là

A. 2-metylpenta-1,3-đien. B. 2-metylpenta-2,4-đien.

C. 4-metylpenta-1,3-đien. D. 2-metylbuta-1,3-đien.
Câu 14: Ankađien B + Cl2 CH2ClC(CH3)=CH-CH2Cl-CH3. Vậy A là

A. 2-metylpenta-1,3-đien. B. 4-metylpenta-2,4-đien.

C. 2-metylpenta-1,4-đien. D. 4-metylpenta-2,3-đien.

Câu 15: Cho 1 Ankađien A + brom(dd) 1,4-đibrom-2-metylbut-2-en. Vậy A là

A. 2-metylbuta-1,3-đien. C. 3-metylbuta-1,3-đien.

B. 2-metylpenta-1,3-đien. D. 3-metylpenta-1,3-đien.

Câu 16: Trùng hợp đivinyl tạo ra cao su Buna có cấu tạo là ?

A. (-C2H-CH-CH-CH2-)n. B. (-CH2-CH=CH-CH2-)n.

C. (-CH2-CH-CH=CH2-)n. D. (-CH2-CH2-CH2-CH2-)n.

Câu 17: Đồng trùng hợp đivinyl và stiren thu được cao su buna-S có công thức cấu tạo là

A. (-CH2-CH=CH-CH2-CH(C6H5)-CH2-)n. B. (-C2H-CH-CH-CH2-CH(C6H5)-CH2-)n.

C. (-CH2-CH-CH=CH2- CH(C6H5)-CH2-)n. D. (-CH2-CH2-CH2-CH2- CH(C6H5)-CH2-)n .

Câu 18: Đồng trùng hợp đivinyl và acrylonitrin (vinyl xianua) thu được cao su buna-N có công thức cấu tạo là

A. (-C2H-CH-CH-CH2-CH(CN)-CH2-)n. B. (-CH2-CH2-CH2-CH2- CH(CN)-CH2-)n.

C. (-CH2-CH-CH=CH2- CH(CN)-CH2-)n. D. (-CH2-CH=CH-CH2-CH(CN)-CH2-)n .

Câu 19: Trùng hợp isopren tạo ra cao su isopren có cấu tạo là

A. (-C2H-C(CH3)-CH-CH2-)n . C. (-CH2-C(CH3)-CH=CH2-)n .

B. (-CH2-C(CH3)=CH-CH2-)n. D. (-CH2-CH(CH3)-CH2-CH2-)n .

Câu 20: Tên gọi của nhóm hiđrocacbon không no có công thức chung là (C5H8)n (n ≥ 2) là

A. ankađien. B. cao su. C. anlen. D. tecpen.

Câu 21: Caroten (licopen) là sắc tố màu đỏ của cà rốt và cà chua chín, công thức phân tử của caroten là

A. C15H25. B. C40H56. C. C10H16. D. C30H50.

Câu 22: Oximen có trong tinh dầu lá húng quế, limonen có trong tinh dầu chanh. Chúng có cùng công thức phân tử là

A. C15H25. B. C40H56. C. C10H16. D. C30H50.

Câu 23: C4H6 có bao nhiêu đồng phân mạch hở ?

A. 5. B. 2. C. 3. D. 4.

Câu 24: Có bao nhiêu ankin ứng với công thức phân tử C5H8 ?

A. 1. B. 2. C. 3. D. 4

Câu 25: Ankin C4H6 có bao nhiêu đồng phân cho phản ứng thế kim loại (phản ứng với dung dịch chứa AgNO3/NH3)

A. 4. B. 2. C. 1. D. 3.

Câu 26: Có bao nhiêu đồng phân ankin C5H8 tác dụng được với dung dịch AgNO3/NH3 tạo kết tủa

A. 3. B. 2. C. 4. D. 1.

Câu 27: Ankin C6H10 có bao nhiêu đồng phân phản ứng với dung dịch AgNO3/NH3 ?

A. 3. B. 4. C. 5. D. 6.

Câu 28: Trong phân tử ankin X, hiđro chiếm 11,111% khối lượng. Có bao nhiêu ankin phù hợp

A. 1. B. 2. C. 3. D. 4

Câu 29: Cho ankin X có công thức cấu tạo sau :

Tên của X là





A. 4-metylpent-2-in. B. 2-metylpent-3-in. C. 4-metylpent-3-in. D. 2-metylpent-4-in.

Câu 30: Cho phản ứng : C2H2 + H2O A

A là chất nào dưới đây



A. CH2=CHOH. B. CH3CHO. C. CH3COOH. D. C2H5OH.

Câu 31: Cho sơ đồ phản ứng sau: CH3-C≡CH + AgNO3/ NH3 X + NH4NO3

X có công thức cấu tạo là?



A. CH3-CAg≡CAg. B. CH3-C≡CAg.

C. AgCH2-C≡CAg. D. A, B, C đều có thể đúng.

Câu 32: Trong số các hiđrocacbon mạch hở sau: C4H10, C4H6, C4H8, C3H4, những hiđrocacbon nào có thể tạo kết tủa với dung dịch AgNO3/NH3 ?

A. C4H10 ,C4H8. B. C4H6, C3H4. C. Chỉ có C4H6. D. Chỉ có C3H4.

Câu 33: Hỗn hợp A gồm hiđro và các hiđrocacbon no, chưa no. Cho A vào bình có niken xúc tác, đun nóng bình một thời gian ta thu được hỗn hợp B. Phát biểu nào sau đây sai ?

A. Đốt cháy hoàn toàn hỗn hợp A cho số mol CO2 và số mol nước luôn bằng số mol CO2 và số mol nước khi đốt cháy hoàn toàn hỗn hợp B.

B. Số mol oxi tiêu tốn để đốt hoàn toàn hỗn hợp A luôn bằng số mol oxi tiêu tốn khi đốt hoàn toàn hỗn hợp B.

C. Số mol A - Số mol B = Số mol H2 tham gia phản ứng.

D. Khối lượng phân tử trung bình của hỗn hợp A bằng khối lượng phân tử trung bình của hỗn hợp B.

Câu 34: Chất nào trong 4 chất dưới đây có thể tham gia cả 4 phản ứng: Phản ứng cháy trong oxi, phản ứng cộng brom, phản ứng cộng hiđro (xúc tác Ni, to), phản ứng thế với dd AgNO3 /NH3

A. etan. B. etilen. C. axetilen. D. xiclopropan.

Câu 35: Câu nào sau đây sai ?

A. Ankin có số đồng phân ít hơn anken tương ứng.

B. Ankin tương tự anken đều có đồng phân hình học.

C. Hai ankin đầu dãy không có đồng phân.

D. Butin có 2 đồng phân vị trí nhóm chức.

Câu 36: Cho các phản ứng sau:



(2) C2H4 + H2 (3) 2 CH≡CH



(4) 3 CH≡CH (5) C2H2 + Ag2O (6) Propin + H2O

Số phản ứng là phản ứng oxi hoá khử là:



A. 2. B. 3. C. 4. D. 5.

Câu 37: Cho dãy chuyển hoá sau: CH4 A B C Cao su buna. Công thức phân tử của B là

A. C4H6. B. C2H5OH. C. C4H4. D. C4H10.

Câu 38: Có chuỗi phản ứng sau:

N + H2 D E (spc) D



Xác định N, B, D, E biết rằng D là một hidrocacbon mạch hở, D chỉ có 1 đồng phân.

A. N : C2H2 ; B : Pd ; D : C2H4 ; E : CH3CH2Cl.

B. N : C4H6 ; B : Pd ; D : C4H8 ; E : CH2ClCH2CH2CH3.

C. N : C3H4 ; B : Pd ; D : C3H6 ; E : CH3CHClCH3.

D. N : C3H4 ; B : Pd ; D : C3H6 ; E : CHCH2CH2Cl.

Câu 39: Chất nào sau đây không điều chế trực tiếp được axetilen ?

A. Ag2C2. B. CH4. C. Al4C3. D. CaC2.

Câu 40: Để làm sạch etilen có lẫn axetilen ta cho hỗn hợp đi qua dd nào sau đây ?

A. dd brom dư. B. dd KMnO4 dư.

C. dd AgNO3 /NH3 dư. D. các cách trên đều đúng.

Câu 41: Để nhận biết các bình riêng biệt đựng các khí không màu sau đây: SO2, C2H2, NH3 ta có thể dùng hoá chất nào sau đây ?

A. Dung dịch AgNO3/NH3. B. Dung dịch Ca(OH)2

C. Giấy quỳ tím khô. D. Dung dịch NaOH

Câu 42: X là một hiđrocacbon khí (ở đktc), mạch hở. Hiđro hoá hoàn toàn X thu được hiđrocacbon no Y có khối lượng phân tử gấp 1,074 lần khối lượng phân tử X. Công thức phân tử X là

A. C2H2. B. C3H4. C. C4H6. D. C3H6.

Câu 43: Chất hữu cơ X có công thức phân tử C6H6 mạch thẳng. Biết 1 mol X tác dụng với AgNO3trong NH3 tạo ra 292 gam kết tủa. CTCT của X có thể là

A. CH ≡CC≡CCH2CH3. C. CH≡CCH2CH=C=CH2.

B. CH≡CCH2C≡CCH3. D. CH≡CCH2CH2C≡CH.

Câu 44: Một hiđrocacbon A mạch thẳng có CTPT C6H6. Khi cho A tác dụng với dung dịch AgNO3/NH3 dư thu được hợp chất hữu cơ B có MB - MA=214 đvC. Xác định CTCT của A ?



1   2   3   4   5   6   7   8   9   ...   15


Cơ sở dữ liệu được bảo vệ bởi bản quyền ©hocday.com 2019
được sử dụng cho việc quản lý

    Quê hương