Andehit – xeton – axit cacboxylic trong đỀ thi đẠi học cao đẲng câu 1



tải về 124.05 Kb.
Chuyển đổi dữ liệu19.09.2016
Kích124.05 Kb.
ANDEHIT – XETON – AXIT CACBOXYLIC TRONG ĐỀ THI ĐẠI HỌC CAO ĐẲNG

Câu 1. Cho các chất: HCN, H2, dung dịch KMnO4, dung dịch Br2. Số chất phản ứng được với (CH3)2CO là

A. 4. B. 1. C. 2. D. 3.

Câu 2. Dãy gồm các chất đều điều chế trực tiếp (bằng một phản ứng) tạo ra anđehit axetic là:

A. CH3COOH, C2H2, C2H4. B. C2H5OH, C2H4, C2H2.

C. HCOOC2H3, C2H2, CH3COOH. D. C2H5OH, C2H2, CH3COOC2H5.

Câu 3. Dãy gồm các chất có thể điều chế trực tiếp (bằng một phản ứng) tạo ra axit axetic là:

A. CH3CHO, C6H12O6 (glucozơ), CH3OH. B. C2H4(OH)2, CH3OH, CH3CHO.



C. CH3CHO, C2H5OH, C2H5COOCH3. D. CH3OH, C2H5OH, CH3CHO.

Câu 4. Quá trình nào sau đây không tạo ra anđehit axetic?

A. CH3−COOCH=CH2 + dung dịch NaOH (to). B. CH2=CH2 + O2 (to, xúc tác).

C. CH2=CH2 + H2O (to, xúc tác HgSO4). D. CH3−CH2OH + CuO (to).

Câu 5. Trong công nghiệp, axeton được điều chế từ.

A. propan-1-ol. B. propan-2-ol. C. xiclopropan. D. cumen.

Câu 6. Số đồng phân xeton ứng với công thức phân tử C5H10O là: A. 6. B. 4. C. 5. D. 3.

Câu 7. Axit cacboxylic no, mạch hở X có công thức thực nghiệm (C3H4O3)n, vậy công thức phân tử của X là

A. C9H12O9. B. C3H4O3. C. C6H8O6. D. C12H16O12.

Câu 8. Oxi hoá 4,48 lít C2H4 (ở đktc) bằng O2 (xúc tác PdCl2, CuCl2), thu được chất X đơn chức. Toàn bộ lượng chất X trên cho tác dụng với HCN (dư) thì được 7,1 gam CH3CH(CN)OH (xianohiđrin). Hiệu suất quá trình tạo CH3CH(CN)OH từ C2H4 là: A. 60%. B. 70%. C. 50%. D. 80%.

Câu 9. Đun nóng V lít hơi anđehit X với 3V lít khí H2 (xúc tác Ni) đến khi phản ứng xảy ra hoàn toàn chỉ thu được một hỗn hợp khí Y có thể tích 2V lít (các thể tích khí đo ở cùng điều kiện nhiệt độ, áp suất). Ngưng tụ Y thu được chất Z; cho Z tác dụng với Na sinh ra H2 có số mol bằng số mol Z đã phản ứng. Chất X là anđehit

A. không no (chứa một nối đôi C=C), hai chức. B. no, hai chức.

C. không no (chứa một nối đôi C=C), đơn chức. D. no, đơn chức.

Câu 10. Hai hợp chất hữu cơ X, Y có cùng công thức phân tử C3H6O2. Cả X và Y đều tác dụng với Na; X tác dụng được với NaHCO3 còn Y có khả năng tham gia phản ứng tráng bạc. Công thức cấu tạo của X và Y lần lượt là

A. HCOOC2H5 và HOCH2COCH3. B. HCOOC2H5 và HOCH2CH2CHO.

C. C2H5COOH và HCOOC2H5. D. C2H5COOH và CH3CH(OH)CHO.



Câu 11. Hai hợp chất hữu cơ X và Y là đồng đẳng kế tiếp, đều tác dụng với Na và có phản ứng tráng bạc. Biết phần trăm khối lượng oxi trong X, Y lần lượt là 53,33% và 43,24%. Công thức cấu tạo của X và Y tương ứng là

A. HCOOCH3 và HCOOCH2-CH3. B. HO-CH(CH3)-CHO và HOOC-CH2-CHO.



C. HO-CH2-CH2-CHO và HO-CH2-CH2-CH2-CHO. D. HO-CH2-CHO và HO-CH2-CH2-CHO.

Câu 12. Cho các hợp chất hữu cơ: (1) ankan; (2) ancol no, đơn chức, mạch hở; (3) xicloankan;(4) ete no, đơn chức, mạch hở;. (5) anken; (6) ancol không no (có một liên kết đôi C=C), mạch hở; (7) ankin; (8) anđehit no, đơn chức, mạch hở; (9) axit no, đơn chức, mạch hở; (10) axit không no (có một liên kết đôi C=C), đơn chức.

Dãy gồm các chất khi đốt cháy hoàn toàn đều cho số mol CO2 bằng số mol H2O là:



A. (2), (3), (5), (7), (9). B. (3), (4), (6), (7), (10). C. (3), (5), (6), (8), (9). D. (1), (3), (5), (6), (8).

Câu 13. Đốt cháy hoàn toàn a mol một anđehit X (mạch hở) tạo ra b mol CO2 và c mol H2O (biết b = a + c). Trong phản ứng tráng gương, một phân tử X chỉ cho 2 electron. X thuộc dãy đồng đẳng anđehit.

A. no, hai chức. B. no, đơn chức.

C. không no có hai nối đôi, đơn chức. D. không no có một nối đôi, đơn chức.

Câu 14. Đốt cháy hoàn toàn 1 mol hợp chất hữu cơ X, thu được 4 mol CO2. Chất X tác dụng được với Na, tham gia phản ứng tráng bạc và phản ứng cộng Br2 theo tỉ lệ mol 1 : 1. Công thức cấu tạo của X là

A. HO-CH2-CH2-CH=CH-CHO. B. HOOC-CH=CH-COOH.

C. HO-CH2-CH2-CH2-CHO. D. HO-CH2-CH=CH-CHO.

Câu 15. Đốt cháy hoàn toàn 0,1 mol một axit cacboxylic đơn chức, cần vừa đủ V lít O2 (ở đktc), thu được 0,3 mol CO2 và 0,2 mol H2O. Giá trị của V là: A. 6,72. B. 4,48. C. 8,96. D. 11,2.

Câu 16. Đốt cháy hoàn toàn một hợp chất hữu cơ X, thu được 0,351 gam H2O và 0,4368 lít khí CO2 (ở đktc). Biết X có phản ứng với Cu(OH)2 trong môi trường kiềm khi đun nóng. Chất X là

A. CH2=CH-CH2-OH. B. C2H5CHO. C. CH3COCH3. D. O=CH-CH=O.

Câu 17. Hiđro hoá hoàn toàn hỗn hợp M gồm hai anđehit X và Y no, đơn chức, mạch hở, kế tiếp nhau trong dãy đồng đẳng (MX < MY), thu được hỗn hợp hai ancol có khối lượng lớn hơn khối lượng M là 1 gam. Đốt cháy hoàn toàn M thu được 30,8 gam CO2. Công thức và phần trăm khối lượng của X lần lượt là

A. HCHO và 32,44%. B. CH3CHO và 49,44%. C. CH3CHO và 67,16%. D. HCHO và 50,56%.

Câu 18. Hiđro hoá hoàn toàn m gam hỗn hợp X gồm hai anđehit no, đơn chức, mạch hở, kế tiếp nhau trong dãy đồng đẳng thu được (m + 1) gam hỗn hợp hai ancol. Mặt khác, khi đốt cháy hoàn toàn cũng m gam X thì cần vừa đủ 17,92 lít khí O2 (ở đktc). Giá trị của m là: A. 10,5. B. 8,8. C. 24,8. D. 17,8.

Câu 19. Cho hỗn hợp khí X gồm HCHO và H2 đi qua ống sứ đựng bột Ni nung nóng. Sau khi phản ứng xảy ra hoàn toàn, thu được hỗn hợp khí Y gồm hai chất hữu cơ. Đốt cháy hết Y thì thu được 11,7 gam H2O và 7,84 lít khí CO2 (ở đktc). Phần trăm theo thể tích của H2 trong X là: A. 35,00%. B. 65,00%. C. 53,85%. D. 46,15%.

Câu 20. Cho dãy các chất: HCHO, CH3COOH, CH3COOC2H5, HCOOH, C2H5OH, HCOOCH3. Số chất trong dãy tham gia phản ứng tráng gương là: A. 5. B. 4. C. 6. D. 3.

Câu 21. Cho hỗn hợp gồm 0,1 mol HCHO và 0,1 mol HCOOH tác dụng với lượng dư Ag2O (hoặc AgNO3) trong dung dịch NH3, đun nóng. Sau khi các phản ứng xảy ra hoàn toàn, khối lượng Ag tạo thành là

A. 64,8 gam. B. 43,2 gam. C. 21,6 gam. D. 10,8 gam.

Câu 22. Đốt cháy hoàn toàn một anđehit X, thu được số mol CO2 bằng số mol H2O. Nếu cho X tác dụng với lượng dư Ag2O (hoặc AgNO3) trong dung dịch NH3, sinh ra số mol Ag gấp bốn lần số mol X đã phản ứng. Công thức của X là

A. (CHO)2. B. C2H5CHO. C. CH3CHO. D. HCHO.

Câu 23. Cho 0,1 mol anđehit X tác dụng với lượng dư AgNO3 (hoặc Ag2O) trong dung dịch NH3, đun nóng thu được 43,2 gam Ag. Hiđro hoá X thu được Y, biết 0,1 mol Y phản ứng vừa đủ với 4,6 gam Na. Công thức cấu tạo thu gọn của X là A. CH3CH(OH)CHO. B. OHC-CHO. C. HCHO. D. CH3CHO.

Câu 24. Cho 0,25 mol một anđehit mạch hở X phản ứng với lượng dư dung dịch AgNO3 trong NH3, thu được 54 gam Ag. Mặt khác, khi cho X phản ứng với H2 dư (xúc tác Ni, to) thì 0,125 mol X phản ứng hết với 0,25 mol H2. Chất X có công thức ứng với công thức chung là

A. CnH2n+1CHO (n ≥0). B. CnH2n-1CHO (n ≥ 2). C. CnH2n-3CHO (n ≥ 2). D. CnH2n(CHO)2 (n ≥ 0).

Câu 25. Cho 2,9 gam một anđehit phản ứng hoàn toàn với lượng dư AgNO3 (hoặc Ag2O) trong dung dịch NH3 thu được 21,6 gam Ag. Công thức cấu tạo thu gọn của anđehit là

A. HCHO. B. CH2=CH-CHO. C. OHC-CHO. D. CH3CHO.

Câu 26. Cho 6,6 gam một anđehit X đơn chức, mạch hở phản ứng với lượng dư AgNO3 (hoặc Ag2O) trong dung dịch NH3, đun nóng. Lượng Ag sinh ra cho phản ứng hết với axit HNO3 loãng, thoát ra 2,24 lít khí NO (sản phẩm khử duy nhất, đo ở đktc). Công thức cấu tạo thu gọn của X là

A. HCHO. B. CH3CHO. C. CH2 = CHCHO. D. CH3CH2CHO.

Câu 27. Cho 3,6 gam anđehit đơn chức X phản ứng hoàn toàn với một lượng dư Ag2O (hoặc AgNO3) trong dung dịch NH3 đun nóng, thu được m gam Ag. Hoà tan hoàn toàn m gam Ag bằng dung dịch HNO3 đặc, sinh ra 2,24 lít NO2 (sản phẩm khử duy nhất, ở đktc). Công thức của X là

A. C3H7CHO. B. C2H5CHO. C. C4H9CHO. D. HCHO.

Câu 28. Cho 0,1 mol hỗn hợp X gồm hai anđehit no, đơn chức, mạch hở, kế tiếp nhau trong dãy đồng đẳng tác dụng với lượng dư dung dịch AgNO3 trong NH3, đun nóng thu được 32,4 gam Ag. Hai anđehit trong X là

A. HCHO và C2H5CHO. B. CH3CHO và C2H5CHO.

C. C2H3CHO và C3H5CHO. D. HCHO và CH3CHO.

Câu 29. Khi oxi hóa hoàn toàn 2,2 gam một anđehit đơn chức thu được 3 gam axit tương ứng. Công thức của anđehit là

A. HCHO. B. CH3CHO. C. C2H3CHO. D. C2H5CHO.

Câu 30. Khi cho a mol một hợp chất hữu cơ X (chứa C, H, O) phản ứng hoàn toàn với Na hoặc với NaHCO3 thì đều sinh ra a mol khí. Chất X là

A. axit ađipic. B. ancol o-hiđroxibenzylic. C. axit 3-hiđroxipropanoic. D. etylen glicol.

Câu 31. Đốt cháy hoàn toàn a mol axit hữu cơ Y được 2a mol CO2. Mặt khác, để trung hòa a mol Y cần vừa đủ 2a mol NaOH. Công thức cấu tạo thu gọn của Y là

A. CH3-COOH. B. HOOC-COOH. C. C2H5-COOH. D. HOOC-CH2-CH2-COOH.



Câu 32. Cho hỗn hợp X gồm hai axit cacboxylic no, mạch không phân nhánh. Đốt cháy hoàn toàn 0,3 mol hỗn hợp X, thu được 11,2 lít khí CO2 (ở đktc). Nếu trung hòa 0,3 mol X thì cần dùng 500 ml dung dịch NaOH 1M. Hai axit đó là:

A. HCOOH, HOOC-CH2-COOH. B. HCOOH, C2H5COOH.

C. HCOOH, CH3COOH. D. HCOOH, HOOC-COOH.

Câu 33. Trung hoà 5,48 gam hỗn hợp gồm axit axetic, phenol và axit benzoic, cần dùng 600 ml dung dịch NaOH 0,1M. Cô cạn dung dịch sau phản ứng, thu được hỗn hợp chất rắn khan có khối lượng là

A. 6,84 gam. B. 4,90 gam. C. 6,80 gam. D. 8,64 gam.

Câu 34. Để trung hòa 6,72 gam một axit cacboxylic Y (no, đơn chức), cần dùng 200 gam dung dịch NaOH 2,24%. Công thức của Y là: A. C2H5COOH. B. HCOOH. C. C3H7COOH. D. CH3COOH.

Câu 35. Cho 5,76 gam axit hữu cơ X đơn chức, mạch hở tác dụng hết với CaCO3 thu được 7,28 gam muối của axit hữu cơ. Công thức cấu tạo thu gọn của X là

A. CH3COOH. B. CH2=CH-COOH. C. CH3-CH2-COOH. D. HC≡C-COOH.



Câu 36. Cho 3,6 gam axit cacboxylic no, đơn chức X tác dụng hoàn toàn với 500 ml dung dịch gồm KOH 0,12M và NaOH 0,12M. Cô cạn dung dịch thu được 8,28 gam hỗn hợp chất rắn khan. Công thức phân tử của X là

A. HCOOH. B. C3H7COOH. C. CH3COOH. D. C2H5COOH.

Câu 37. Cho 0,04 mol một hỗn hợp X gồm CH2=CH-COOH, CH3COOH và CH2=CH-CHO phản ứng vừa đủ với dung dịch chứa 6,4 gam brom. Mặt khác, để trung hoà 0,04 mol X cần dùng vừa đủ 40 ml dung dịch NaOH 0,75 M. Khối lượng của CH2=CH-COOH trong X là: A. 1,44 gam. B. 0,56 gam. C. 0,72 gam. D. 2,88 gam.

Câu 38. Trung hoà 8,2 gam hỗn hợp gồm axit fomic và một axit đơn chức X cần 100 ml dung dịch NaOH 1,5M. Nếu cho 8,2 gam hỗn hợp trên tác dụng với một lượng dư dung dịch AgNO3 trong NH3, đun nóng thì thu được 21,6 gam Ag. Tên gọi của X là: A. axit metacrylic. B. axit propanoic. C. axit acrylic. D. axit etanoic.

Câu 39. Hỗn hợp X gồm axit Y đơn chức và axit Z hai chức (Y, Z có cùng số nguyên tử cacbon). Chia X thành hai phần bằng nhau. Cho phần một tác dụng hết với Na, sinh ra 4,48 lít khí H2 (ở đktc).Đốt cháy hoàn toàn phần hai, sinh ra 26,4 gam CO2. Công thức cấu tạo thu gọn và phần trăm về khối lượng của Z trong hỗn hợp X lần lượt là

A. HOOC-CH2-COOH và 54,88%. B. HOOC-COOH và 42,86%.



C. HOOC-COOH và 60,00%. D. HOOC-CH2-COOH và 70,87%.

Câu 40. Anđehit no mạch hở X có công thức đơn giản nhất C2H3O. Công thức phân tử của X là

A. C6H9O3. B. C4H6O2. C. C8H12O4. D. C2H3O.

Câu 41. Oxi hoá không hoàn toàn ancol isopropylic bằng CuO nung nóng, thu được chất hữu cơ X. Tên gọi của X là

A. metyl phenyl xeton. B. propanal. C. đimetyl xeton. D. metyl vinyl xeton.

Câu 42. Ở điều kiện thích hợp: chất X phản ứng với chất Y tạo ra anđehit axetic; chất X phản ứng với chất Z tạo ra ancol etylic. Các chất X, Y, Z lần lượt là:

A. C2H2, H2O, H2. B. C2H2, O2, H2O. C. C2H4, O2, H2O. D. C2H4, H2O, CO.

Câu 43. Axeton được điều chế bằng cách oxi hoá cumen nhờ oxi, sau đó thuỷ phân trong dung dịch H2SO4 loãng. Để thu được 145 gam axeton thì lượng cumen cần dùng (giả sử hiệu suất quá trình điều chế đạt 75%) là

A. 400 gam. B. 600 gam. C. 500 gam. D. 300 gam.

Câu 44. Đốt cháy hoàn toàn 2,76 gam hỗn hợp X gồm CxHyCOOH, CxHyCOOCH3, CH3OH thu được 2,688 lít CO2 (đktc) và 1,8 gam H2O. Mặt khác, cho 2,76 gam X phản ứng vừa đủ với 30 ml dung dịch NaOH 1M, thu được 0,96 gam CH3OH. Công thức của CxHyCOOH là A. CH3COOH. B. C2H5COOH. C. C2H3COOH. D. C3H5COOH.

Câu 45. Hỗn hợp X gồm axit panmitic, axit stearic và axit linoleic. Để trung hoà m gam X cần 40 ml dung dịch NaOH 1M. Mặt khác, nếu đốt cháy hoàn toàn m gam X thì thu được 15,232 lít khí CO2 (đktc) và 11,7 gam H2O. Số mol của axit linoleic trong m gam hỗn hợp X là: A. 0,010. B. 0,015. C. 0,020. D. 0,005.

Câu 46. Hỗn hợp X gồm 1 ancol và 2 sản phẩm hợp nước của propen. Tỉ khối hơi của X so với hiđro bằng 23. Cho m gam X đi qua ống sứ đựng CuO (dư) nung nóng. Sau khi các phản ứng xảy ra hoàn toàn, thu được hỗn hợp Y gồm 3 chất hữu cơ và hơi nước, khối lượng ống sứ giảm 3,2 gam. Cho Y tác dụng hoàn toàn với lượng dư dung dịch AgNO3 trong NH3, tạo ra 48,6 gam Ag. Phần trăm khối lượng của propan-1-ol trong X là A. 16,3%. B. 65,2%. C. 48,9%. D. 83,7%.

Câu 47. Cho m gam hỗn hợp etanal và propanal phản ứng hoàn toàn với lượng dư dung dịch AgNO3 trong NH3, thu được 43,2 gam kết tủa và dung dịch chứa 17,5 gam muối amoni của hai axit hữu cơ. Giá trị của m là

A. 10,2. B. 10,9. C. 9,5. D. 14,3.

Câu 48. Cho 16,4 gam hỗn hợp X gồm 2 axit cacboxylic là đồng đẳng kế tiếp nhau phản ứng hoàn toàn với 200 ml dung dịch NaOH 1M và KOH 1M, thu được dung dịch Y. Cô cạn dung dịch Y, thu được 31,1 gam hỗn hợp chất rắn khan. Công thức của 2 axit trong X là:

A. C3H6O2 và C4H8O2. B. C3H4O2 và C4H6O2. C. C2H4O2 và C3H4O2. D. C2H4O2 và C3H6O2.

Câu 49. Axit cacboxylic X có công thức đơn giản nhất là C3H5O2. Khi cho 100 ml dung dịch axit X nồng độ 0,1M phản ứng hết với dung dịch NaHCO3 (dư), thu được V ml khí CO2 (đktc). Giá trị của V là:

A. 336. B. 112. C. 448. D. 224.

Câu 50. Hỗn hợp gồm 0,1 mol một axit cacboxylic đơn chức và 0,1 mol muối của axit đó với kim loại kiềm có tổng khối lượng là 15,8 gam. Tên của axit trên là A. axit etanoic. B. axit propanoic. C. axit butanoic. D. axit metanoic.

Câu 51. Hỗn hợp Z gồm hai axit cacboxylic đơn chức X và Y (MX > MY ) có tổng khối lượng là 8,2 gam. Cho Z tác dụng vừa đủ với dung dịch NaOH, thu được dung dịch chứa 11,5 gam muối. Mặt khác, nếu cho Z tác dụng với một lượng dư dung dịch AgNO3 trong NH3, thu được 21,6 gam Ag. Công thức và phần trăm khối lượng của X trong Z là

A. C2H3COOH và 43,90%. B. C3H5COOH và 54,88%. C. C2H5COOH và 56,10%. D. HCOOH và 45,12%.

PHẦN LÍ THUYẾT:



Câu 1: Một anđehit có công thức tổng quát là CnH2n + 2 – 2a – m (CHO)m. Các giá trị n, a, m lần lượt được xác định là

A. n > 0, a 0, m 1. B. n 0, a 0, m 1. C. n > 0, a > 0, m > 1. D. n 0, a > 0, m 1.

Câu 2: Có bao nhiêu đồng phân cấu tạo C5H10O có khả năng tham gia phản ứng tráng gương ?

A. 2. B. 3. C. 4. D. 5.

Câu 3: Có bao nhiêu xeton có công thức phân tử là C5H10O ?

A. 1. B. 2. C. 3. D. 4.

Câu 4: Có bao nhiêu đồng phân cấu tạo C6H12O tham gia phản ứng tráng gương ?

A. 6. B. 7. C. 8. D. 9.

Câu 5: Có bao nhiêu ancol C5H12O khi tác dụng với CuO đun nóng cho ra anđehit ?

A. 1. B. 2. C. 3. D. 4.

Câu 6: CTĐGN của 1 anđehit no, đa chức, mạch hở là C2H3O. CTPT của nó là

A. C8H12O4. B. C4H6O. C. C12H18O6. D. C4H6O2.

Câu 7: CTĐGN của anđehit no, đa chức, mạch hở là C2H3O. Anđehit đó có số đồng phân là

A. 2. B. 4. C. 1. D. 3.

Câu 8: (CH3)2CHCHO có tên là

A. isobutyranđehit. B. anđehit isobutyric. C. 2-metyl propanal. D. A, B, C đều đúng.

Câu 9: CTPT của ankanal có 10,345% H theo khối lượng là

A. HCHO. B. CH3CHO. C. C2H5CHO. D. C3H7CHO.

Câu 10: Anđehit A (chỉ chứa một loại nhóm chức) có %C và %H (theo khối lượng) lần lượt là 55,81 và 6,97. Chỉ ra phát biểu sai

A. A là anđehit hai chức. B. A còn có đồng phân là các axit cacboxylic.

C. A là anđehit no. D. Trong phản ứng tráng gương, một phân tử A chỉ cho 2 electron.



Câu 11: Trong cùng điều kiện nhiệt độ và áp suất, 1 lít hơi anđehit A có khối lượng bằng khối lượng 1 lít CO2. A là

A. anđehit fomic. B. anđehit axetic. C. anđehit acrylic. D. anđehit benzoic.

Câu 12: Đốt cháy hoàn toàn p mol anđehit X được q mol CO2 và t mol H2O. Biết p = q - t. Mặt khác 1 mol X tráng gương được 4 mol Ag. X thuộc dãy đồng đẳng anđehit

A. đơn chức, no, mạch hở. C. hai chức chưa no (1 nối đôi C=C).

B. hai chức, no, mạch hở. D. nhị chức chưa no (1 nối ba C≡C).

Câu 13: Anđehit đa chức A cháy hoàn toàn cho mol CO2 - mol H2O = mol A. A là

A. anđehit no, mạch hở. B. anđehit chưa no. C. anđehit thơm. D. anđehit no, mạch vòng.

Câu 14: Đốt cháy anđehit A được mol CO2 = mol H2O. A là

A. anđehit no, mạch hở, đơn chức. B. anđehit đơn chức, no, mạch vòng.

C. anđehit đơn chức có 1 nối đôi, mạch hở. D. anđehit no 2 chức, mạch hở.

Câu 15: Đun nóng V lít hơi anđehit X với 3V lít khí H2 (xúc tác Ni) đến khi phản ứng xảy ra hoàn toàn chỉ thu được một hỗn hợp khí Y có thể tích 2V lít (các thể tích khí đo ở cùng điều kiện nhiệt độ, áp suất). Ngưng tụ Y thu được chất Z ; cho Z tác dụng với Na sinh ra H2 có số mol bằng số mol Z đã phản ứng. Chất X là anđehit

A. no, hai chức. B. không no (chứa một nối đôi C=C), hai chức.

C. no, đơn chức. D. không no (chứa một nối đôi C=C), đơn chức.

Câu 16: Cho các chất : HCN, H2, dung dịch KMnO4, dung dịch Br2/H2O, dung dịch Br2/CH3COOH

a. Số chất phản ứng được với (CH3)2CO ở điều kiện thích hợp là



A. 2. B. 3. C. 4. D. 5.

b. Số chất phản ứng được với CH3CH2CHO ở điều kiện thích hợp là



A. 4. B. 2. C. 3. D. 5.

Câu 17: CH3CHO có thể tạo thành trực tiếp từ

A. CH3COOCH=CH2. B. C2H2. C. C2H5OH. D. Tất cả đều đúng.

Câu 18: Quá trình nào sau đây không tạo ra anđehit axetic ?

A. CH2=CH2+ H2O (to, xúc tác HgSO4). B. CH2=CH2 + O2 (to, xúc tác).

C. CH3COOCH=CH2 + dung dịch NaOH (to). D. CH3CH2OH + CuO (to).

Câu 19: Dãy gồm các chất đều điều chế trực tiếp (bằng một phản ứng) tạo ra anđehit axetic là

A. C2H5OH, C2H2, CH3COOC2H5. B. HCOOC2H3, C2H2, CH3COOH.

C. C2H5OH, C2H4, C2H2. D. CH3COOH, C2H2, C2H4.

Câu 20: Một axit cacboxylic có công thức tổng quát là CnH2n + 2 – 2a – m (COOH)m. Các giá trị n, a, m lần lượt được xác định là

A. n > 0, a 0, m 1. B. n 0, a 0, m 1. C. n > 0, a > 0, m > 1. D. n 0, a > 0, m 1.

Câu 21: A là axit no hở, công thức CxHyOz. Chỉ ra mối liên hệ đúng

A. y = 2x-z +2. B. y = 2x + z-2. C. y = 2x. D. y = 2x-z.

Câu 22: A là axit cacboxylic mạch hở, chưa no (1 nối đôi C=C), công thức CxHyOz. Chỉ ra mối liên hệ đúng

A. y = 2x. B. y = 2x + 2-z. C. y = 2x-z. D. y = 2x + z-2.

Câu 23: Axit không no, đơn chức có một liên kết đôi trong gốc hiđrocacbon có công thức phù hợp là

A. CnH2n+1-2kCOOH ( n 2). B. RCOOH. C. CnH2n-1COOH ( n 2). D. CnH2n+1COOH ( n 1).

Câu 24: Axit cacboxylic A có công thức đơn giản nhất là C3H4O3. A có công thức phân tử là

A. C3H4O3. B. C6H8O6. C. C18H24O18. D. C12H16O12.

Câu 25: CTĐGN của một axit hữu cơ X là CHO. Đốt cháy 1 mol X thu được dưới 6 mol CO2. CTCT của X là

A. CH3COOH. B. CH2=CHCOOH. C. HOOCCH=CHCOOH. D. Kết quả khác.

Câu 26: Một axit no A có CTĐGN là C2H3O2. CTPT của axit A là

A. C6H9O6. B. C2H3O2. C. C4H6O4. D. C8H12O8.

Câu 27: C4H6O2 có số đồng phân mạch hở thuộc chức axit là

A. 4. B. 3. C. 5. D. tất cả đều sai.

Câu 28: Axit cacboxylic đơn chức mạch hở phân nhánh (A) có % O (theo khối lượng) là 37,2. Chỉ ra phát biểu sai

A. A làm mất màu dung dịch brom. B. A là nguyên liệu để điều chế thủy tinh hữu cơ.

C. A có đồng phân hình học. D. A có hai liên trong phân tử.

Câu 29: Axit hữu cơ A có thành phần nguyên tố gồm 40,68% C ; 54,24% O. Để trung hòa 0,05 mol A cần 100ml dung dịch NaOH 1M. CTCT của A là A. HOOCCH2CH2COOH. B. HOOCCH(CH3)CH2COOH. C. HOOCCH2COOH. D. HOOCCOOH.

Câu 30: Hợp chất CH3CH2(CH3)CH2CH2CH(C2H5)COOH có tên quốc tế là

A. axit 2-etyl-5-metyl hexanoic. B. axit 2-etyl-5-metyl nonanoic.

C. axit 5-etyl-2-metyl hexanoic. D. tên gọi khác.

Câu 31: Giấm ăn là dung dịch axit axetic có nồng độ là

A. 2% 5%. B. 59%. C. 912%. D. 1215%.

Câu 32: Axit axetic tác dụng được với dung dịch nào ?

A. natri etylat. B. amoni cacbonat. C. natri phenolat. D. Cả A, B, C.

Câu 33: Trong dãy đồng đẳng của các axit đơn chức no, HCOOH là axit có độ mạnh trung bình, còn lại là axit yếu (điện li không hoàn toàn). Dung dịch axit axetic có nồng độ 0,001 mol/l có pH là A. 3 < pH < 7. B. < 3. C. 3. D. 10-3

Câu 34: Độ điện li của 3 dung dịch CH3COOH 0,1M ; CH3COOH 0,01M và HCl được sắp xếp theo thứ tự tăng dần là

A. CH3COOH 0,01M < HCl < CH3COOH 0,1M. B. CH3COOH 0,01M < CH3COOH 0,1M < HCl.

C. HCl < CH3COOH 0,1M < CH3COOH 0,01M. D. CH3COOH 0,1M < CH3COOH 0,01M < HCl.

Câu 35: Thứ tự sắp xếp theo sự tăng dần tính axit của CH3COOH ; C2H5OH ; CO2 và C6H5OH là

A. C6H5OH < CO2 < CH3COOH < C2H5OH. B. CH3COOH < C6H5OH < CO2 < C2H5OH.

C. C2H5OH < C6H5OH < CO2 < CH3COOH. D. C2H5OH < CH3COOH < C6H5OH < CO2.

Câu 36: Cho 3 axit ClCH2COOH , BrCH2COOH, ICH2COOH, dãy sắp xếp theo thứ tự tăng dần tính axit là

A. ClCH2COOH < ICH2COOH < BrCH2COOH. B. ClCH2COOH < BrCH2COOH < ICH2COOH.

C. ICH2COOH < BrCH2COOH < ClCH2COOH. D. BrCH2COOH < ClCH2COOH < ICH2COOH.

Câu 37: Giá trị pH của các axit CH3COOH, HCl, H2SO4 được sắp xếp theo thứ tự tăng dần là

A. H2SO4, CH3COOH, HCl. B. CH3COOH, HCl , H2SO4. C. H2SO4, HCl, CH3COOH. D. HCl, CH3COOH, H2SO4.

Câu 38: Trong các phản ứng este hóa giữa ancol và axit hữu cơ thì cân bằng sẽ chuyển dịch theo chiều thuận khi ta

A. dùng chất háo nước để tách nước. B. chưng cất ngay để tách este ra.

C. cho ancol dư hoặc axit dư. D. tất cả đều đúng.

Câu 39: Đốt cháy hoàn toàn hỗn hợp X gồm 2 axit cacboxylic được mol CO2 = mol H2O. X gồm

A. 1 axit đơn chức, 1 axit đa chức. B. 1 axit no, 1 axit chưa no.

C. 2 axit đơn chức no mạch vòng D. 2 axit no, mạch hở đơn chức.

Câu 40: Để trung hòa 0,2 mol hỗn hợp X gồm 2 axit cacboxylic cần 0,3 mol NaOH. X gồm có

A. 2 axit cùng dãy đồng đẳng. B. 1 axit đơn chức, 1 axit hai chức.

C. 2 axit đa chức. D. 1 axit đơn chức, 1 axit đa chức.

Câu 41: Đốt cháy hoàn toàn axit cacboxylic A bằng lượng vừa đủ oxi được hỗn hợp (khí và hơi) có tỉ khối so với H2 là 15,5. A là axit

A. đơn chức no, mạch hở B. đơn chức có 1 nối đôi (C = C), mạch hở.

C. đa chức no, mạch hở. D. axit no,mạch hở, hai chức,

Câu 42: Đốt cháy hết 1 thể tích hơi axit A thu được 2 thể tích CO2 đo ở cùng điều kiện, A là

A. HCOOH. B. HOOCCOOH. C. CH3COOH. D. B và C đúng.

Câu 43: Có thể điều chế CH3COOH từ

A. CH3CHO. B. C2H5OH. C. CH3CCl3. D. Tất cả đều đúng.

Câu 44: Cho các chất : CaC2 (I), CH3CHO (II), CH3COOH (III), C2H2 (IV). Sơ đồ chuyển hóa đúng để điều chế axit axetic là

A. I IV II III. B. IV I II III.

C. I II IV III. D. II I IV III.

Câu 45: Dãy gồm các chất có thể điều chế trực tiếp (bằng một phản ứng) tạo ra axit axetic là

A. CH3CHO, C2H5OH, C2H5COOCH3. B. CH3CHO, C6H12O6 (glucozơ), CH3OH.

C. CH3OH, C2H5OH, CH3CHO. D. C2H4(OH)2, CH3OH, CH3CHO.

Câu 46: Cho sơ đồ chuyển hóa : CH3CH2Cl + KCN X (1); X + H3O­+ (đun nóng) Y(2) Công thức cấu tạo của X, Y lần lượt là

A. CH3CH2NH2, CH3CH2COOH. B. CH3CH2CN, CH3CH2CHO.

C. CH3CH2CN, CH3CH2COOH. D. CH3CH2CN, CH3CH2COONH4.

Câu 47: Chất có nhiệt độ sôi cao nhất là A. CH3CHO. B. C2H5OH. C. CH3COOH. D. C2H6.

Câu 48: Nhiệt độ sôi của mỗi chất tương ứng trong dãy các chất sau đây, dãy nào hợp lý nhất ? C2H5OH HCOOH CH3COOH

A. 118,2oC 78,3oC 100,5oC B. 118,2oC 100,5oC 78,3oC

C. 100,5oC 78,3oC 118,2oC D. 78,3oC 100,5oC 118,2oC

Câu 49: Chỉ ra thứ tự tăng dần nhiệt độ sôi của các chất ?

A. CH3CHO; C2H5OH ; CH3COOH. C. C2H5OH ; CH3COOH ; CH3CHO.

B. CH3CHO ;CH3COOH ; C2H5OH. D. CH3COOH ; C2H5OH ; CH3CHO.

Câu 50: Nhiệt độ sôi của các chất được sắp xếp theo thứ tự tăng dần là

A. CH3OH < CH3CH2COOH < NH3 < HCl. B. C2H5Cl < CH3COOH < C2H5OH.

C. C2H5Cl < CH3COOCH3 < C2H5OH < CH3COOH. D. HCOOH < CH3OH < CH3COOH < C2H5F.

Câu 51: Cho các chất CH3CH2COOH (X) ; CH3COOH ( Y) ; C2H5OH ( Z) ; CH3OCH3 (T). Dãy gồm các chất được sắp xếp tăng dần theo nhiệt độ sôi là A. T, X, Y, Z. B. T, Z, Y, X. C. Z, T, Y, X. D. Y, T, Z, X.

Câu 52: Nhiệt độ sôi của ancol etylic (I), anđehit axetic (II), axit axetic (III) và axit propionic (IV) sắp xếp theo thứ tự giảm dần là

A. IV > I > III > II. B. IV > III > I > II. C. II > III > I > IV. D. I > II > III > IV.

Câu 53: A là ancol đơn chức no hở, B là axit cacboxylic no hở đơn chức. Biết MA=MB. Phát biểu đúng là

A. A, B là đồng phân B. A, B có cùng số cacbon trong phân tử.

C. A hơn B một nguyên tử cacbon. D. B hơn A một nguyên tử cacbon.

Câu 54: Hai hợp chất hữu cơ X và Y có cùng CTPT C3H4O2. X tác dụng với CaCO3 tạo ra CO2. Y tác dụng với dung dịch AgNO3/NH3 tạo Ag. CTCT thu gọn phù hợp của X, Y lần lượt là

A. HCOOCH=CH2, CH3COOCH3. B. CH3CH2COOH, HCOOCH2CH3.

C. HCOOCH=CH2, CH3 CH2COOH. D. CH2=CHCOOH, HOCCH2CHO.

Câu 55: Cho chuỗi phản ứng : C2H6O X axit axetic Y. CTCT của X, Y lần lượt là

A. CH3CHO, CH3CH2COOH. B. CH3CHO, CH3COOCH3.

C. CH3CHO, CH2(OH)CH2CHO. D. CH3CHO, HCOOCH2CH3.

Câu 56: Cho sơ đồ phản ứng sau : CHCH butin-1,4-điol Y Z. Y và Z lần lượt là

A. HOCH2CH2CH2CH3 ; CH2=CHCH=CH2. B. HOCH2CH2CH2CH2OH ; CH2=CHCH2CH3.

C. HOCH2CH2CH2CH2OH ; CH2=CHCH = CH2. D. HOCH2CH2CH2CH2OH ; CH3CH2CH2CH3.

Câu 57: Cho sơ đồ chuyển hóa sau:

Hiđrocacbon A B C D HOOCCH2COOH. Vậy A là



A. B. C3H8. C. CH2=CHCH3. D. CH2=CHCOOH.

Câu 58: Cho chuỗi phản ứng sau

C3H6 B1 B2 (spc) B3 B4 . Vậy B4



A. CH3COCH3. B. A và C đúng. C. CH3CH2CHO. D. CH3CHOHCH3.

Câu 59: Xét các chuỗi biến hóa sau: a. A B C cao su Buna.

CTCT của A là A. OHCCH2CH2CHO. B. CH3CHO. C. OHC(CH2)2CH2OH. D. A, B, C đều đúng.

b. A B C cao su Buna. CTCT của A là

A. OHCCH2CH2CHO. B. CH3CHO. C. HOC(CH2)2CH2OH. D. A, B, C đều đúng.

Câu 60: Cho sơ đồ chuyển hóa sau :

C2H6 A B C D. Vậy D là



A. CH3CH2OH. B. CH3CHO. C. CH3COCH3. D. CH3COOH.

Câu 61: Cho sơ đồ chuyển hóa sau

C2H4 A1 A2 A3 A4 A5.

Chọn câu trả lời sai

A. A5 có CTCT là HOOCCOOH. B. A4 là mộtđianđehit. C. A2 là một điol. D. A5 là một điaxit.

Câu 62: Cho chuỗi biến hóa sau :

a. Chất A có thể là A. natri etylat. B. anđehit axetic. C. etyl axetat. D. A, B, C đều đúng.

b. Chất B có thể là A. etilen. B. tinh bột. C. glucozơ. D. A, B, C đều sai.

c. Chất C có thể là A. etanal. B. axetilen. C. etylbromua. D. A, C đều đúng.

Câu 63: Một hợp chất có thành phần là 40% C ; 6,7% H và 53,3% O. Hợp chất có CTĐGN là

A. C6H8O. B. C2H4O. C. CH2O. D. C3H6O.

Câu 64: Phát biểu đúng là

A. Axit chưa no khi cháy luôn cho số mol CO2 lớn hơn số mol H2O. B. anđehit tác dụng với H2 (xúc tác Ni) luôn tạo ancol bậc nhất.

C. anđehit vừa có tính khử vừa có tính oxi hóa. D. A, B, C đều đúng.

Câu 65: Cho các chất sau : (1) CH2=CHCH2OH ; (2) CH3CH2CHO ; (3) CH3COCH3. Phát biểu đúng là

A. 1, 2, 3 là các đồng phân. B. 3 tác dụng với H2 (xúc tác Ni) tạo 1 ancol bậc 2.

C. 1, 2 tác dụng với H2 (xúc tác Ni) đều tạo ra 1 ancol. D. A, B, C đều đúng.

Câu 66: Cho 4 hợp chất có CTPT là M : C3H6O ; N : C3H6O2 ; P : C3H4O ; Q : C3H4O2.

Biết : M và P cho phản ứng tráng gương;N và Q phản ứng được với dung dịch NaOH;Q phản ứng với H2 tạo thành N ; oxi hóa P thu được Q.

a. M và P theo thứ tự là

A. C2H5COOH ; CH2=CHCOOH. B. C2H5CHO ; CH2=CHCHO. C. CH2=CHCOOH ; C2H5COOH . D. CH2=CHCHO ; C2H5CHO.

b. N và Q theo thứ tự là



A. C2H5COOH ; CH2 = CHCOOH. B. CH2=CHCOOH ; C2H5COOH.

C. C2H5CHO ; CH2=CHCHO. D. CH2=CHCHO ; C2H5CHO.

Câu 67: Cho các chất sau: (1) CH2=CHCH2OH ; (2) HOCCH2CHO ; (3) HCOOCH=CH2. Phát biểu đúng là

A. 1, 2, 3 tác dụng được với Na. B. Trong A, B, C có 2 chất cho phản ứng tráng gương.

C. 1, 2, 3 là các đồng phân. D. 1, 2, 3 cháy đều cho số mol H2O bé hơn số mol CO2.

Câu 68: Hai hợp chất hữu cơ X, Y có cùng công thức phân tử C3H6O2. Cả X và Y đều tác dụng với Na ; X tác dụng được với NaHCO3 còn Y có khả năng tham gia phản ứng tráng bạc. Công thức cấu tạo của X và Y lần lượt là

A. C2H5COOH và HCOOC2H5. B. HCOOC2H5 và HOCH2OCH3.

C. HCOOC2H5 và HOCH2CH2CHO. D. C2H5COOH và CH3CH(OH)CHO.

Câu 69: Cho dãy các chất : HCHO, CH3COOH, HCOONa, HCOOH, C2H5OH, HCOOCH3. Số chất trong dãy tham gia phản ứng tráng gương là A. 3. B. 6. C. 4. D. 5.

Câu 70: Cho các chất sau : phenol, etanol, axit axetic, natri phenolat, natri hiđroxit. Số cặp chất tác dụng được với nhau là

A. 4. B. 3. C. 2. D. 1.

Câu 71: Hai chất hữu cơ X1 và X2 đều có khối lượng phân tử bằng 60 đvC. X1 có khả năng phản ứng với: Na, NaOH, Na2CO3. X2 phản ứng với NaOH (đun nóng) nhưng không phản ứng Na. Công thức cấu tạo của X1, X2 lần lượt là

A. CH3COOH, CH3COOCH3. B. (CH3)2CHOH, HCOOCH3.

C. HCOOCH3, CH3COOH. D. CH3COOH, HCOOCH­3.

Câu 72: Cho tất cả các đồng phân mạch hở, có cùng công thức phân tử C2H4O2 lần lượt tác dụng với : Na, NaOH, NaHCO3. Số phản ứng xảy ra là A. 2. B. 5. C. 4. D. 3.

Câu 73: Cho các chất sau : CH3CH2CHO (1) ; CH2=CHCHO (2) ; CH≡CCHO (3) ; CH2=CHCH2OH (4) ;(CH3)2CHOH (5). Những chất phản ứng hoàn toàn với lượng dư H2 (Ni, to) cùng tạo ra một sản phẩm là

A. (2), (3), (4), (5). B. (1), (2), (4), (5). C. (1), (2), (3). D. (1), (2), (3), (4).

Câu 74: Cho các hợp chất hữu cơ : C2H4 ; C2H2 ; CH2O ; CH2O2 (mạch hở); C3H4O2 (mạch hở, đơn chức). Biết C3H4O2 không làm chuyển màu quỳ tím ẩm.

a. Số chất tác dụng được với dung dịch AgNO3/NH3 tạo ra Ag là



A. 2. B. 4. C. 3. D. 5.

b. Số chất tác dụng được với dung dịch AgNO3/NH3 tạo ra kết tủa là



A. 2. B. 4. C. 3. D. 5.

Câu 75: Có thể phân biệt 3 lọ mất nhãn chứa: HCOOH ; CH3COOH ; C2H5OH với hóa chất nào dưới đây ?

A. dd AgNO3/NH3. B. NaOH. C. Na. D. Cu(OH)2/OH-.

Câu 76: Chỉ dùng thuốc thử nào dưới đây có thể phân biệt 4 lọ mất nhãn chứa : fomon ; axit fomic ;

axit axetic ; ancol etylic ? A. dd AgNO3/NH3. B. CuO. C. Cu(OH)2/OH-. D. NaOH.



Câu 77: Chỉ dùng thuốc thử nào dưới đây có thể phân biệt 4 lọ mất nhãn chứa : etylen glicol ; axit fomic ; fomon ; ancol etylic ?

A. dd AgNO3/NH3 B. CuO. C. Cu(OH)2/OH-. D. NaOH.

Câu 78: Chỉ dùng quỳ tím và nước brom có thể phân biệt được những chất nào sau đây ?

A. axit fomic ; axit axetic ; axit acrylic ; axit propionic. B. Axit axetic; axit acrylic; anilin; toluen; axit fomic.

C. Ancol etylic; ancol metylic; axit axetic; axit propionic. D. Ancol etylic; ancol metylic ; phenol ; anilin.

Câu 79: Để phân biệt 3 mẫu hóa chất riêng biệt : phenol, axit acrylic, axit axetic bằng một thuốc thử, người ta dùng thuốc thử

A. dung dịch Na2CO3. B. CaCO3. C. dung dịch Br2. D. dung dịch AgNO3/NH3.

Câu 80: Để phân biệt axit propionic và axit acrylic ta dùng

A. dung dịch Na2CO3. B. dung dịch Br2. C. dung dịch C2H5OH. D. dung dịch NaOH.

Câu 81: Có thể phân biệt CH3CHO và C2H5OH bằng phản ứng với

A. Na. B. Cu(OH)2/NaOH. C. AgNO3/NH3. D. Tất cả đều đúng.

Câu 82: Để phân biệt 3 dung dịch riêng biệt : axit axetic, axit acrylic, axit fomic người ta dùng theo thứ tự các thuốc thử sau

A. dung dịch Br2/CCl4. B. dung dịch Br2/H2O. C. dung dịch Na2CO3. D. dung dịch AgNO3/NH3 dư.

Câu 83: Để phân biệt HCOOH và CH3COOH ta dùng

A. Na. B. AgNO3/NH3. C. CaCO3. D. NaOH.

Câu 84: Tráng gương hoàn toàn hợp chất hữu cơ X bằng AgNO3/NH3 thu được hỗn hợp sản phẩm chỉ gồm các chất vô cơ. X có cấu tạo

A. HCHO. B. HCOONH4. C. HCOOH. D. Tất cả đều đúng.

Câu 85: Có thể phân biệt HCOOCH3 và CH3COOH bằng

A. AgNO3/NH3 B. CaCO3. C. Na. D. Tất cả đều đúng.

Câu 86: Chất tạo được kết tủa đỏ gạch khi đun nóng với Cu(OH)2

A. HCHO. B. HCOOCH3. C. HCOOH. D. Tất cả đều đúng.

Câu 87: Chỉ dùng 1 hóa chất nào sau đây để phân biệt các dung dịch : ancol etylic, glixerol, fomalin ?

A. Cu(OH)2 , toC. B. Na. C. AgNO3 / NH3. D. A, B, C đều đúng.




Cơ sở dữ liệu được bảo vệ bởi bản quyền ©hocday.com 2019
được sử dụng cho việc quản lý

    Quê hương